ChemNet > CAS > 118337-33-0 2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one
118337-33-0 2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one
שם המוצר |
2-bromo-1-(3-methylbenzo[b]thiophen-2-yl)ethan-1-one |
נרדפות |
2-bromo-1-(3-methyl-1-benzothiophen-2-yl)ethanone; 2-bromo-1-(5-chloro-3-methyl-1-benzothiophen-2-yl)ethanone |
מולקולרית פורמולה |
C11H8BrClOS |
משקל מולקולרי |
303.6026 |
InChI |
InChI=1/C11H8BrClOS/c1-6-8-4-7(13)2-3-10(8)15-11(6)9(14)5-12/h2-4H,5H2,1H3 |
מספר CAS |
118337-33-0 |
מבנה מולקולרי |
|
צפיפות |
1.632g/cm3 |
נקודת ההתוך |
94℃ |
נקודת רתיחה |
396.2°C at 760 mmHg |
משקל סגולי |
1.676 |
נקודת הבזק |
193.4°C |
Hazard סימנים |
C:Corrosive;
|
סיכונים קודי |
R34:Causes burns.;
|
בטיחות תיאור |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|